C12H22N2O6 — CID 82944278
(2S)-2-(3-propoxypropylcarbamoylamino)pentanedioic acid (PubChem CID 82944278) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is (2S)-2-(3-propoxypropylcarbamoylamino)pentanedioic acid.
| Compound Name | (2S)-2-(3-propoxypropylcarbamoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 82944278 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (2S)-2-(3-propoxypropylcarbamoylamino)pentanedioic acid |
| SMILES | CCCOCCCNC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H22N2O6/c1-2-7-20-8-3-6-13-12(19)14-9(11(17)18)4-5-10(15)16/h9H,2-8H2,1H3,(H,15,16)(H,17,18)(H2,13,14,19)/t9-/m0/s1 |
| InChIKey | DTDNKBHKAYVOLO-VIFPVBQESA-N |
| XLogP | 0.42 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|