C19H35N5O10 — CID 171470743
(2S)-2-[[(1S)-5-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 171470743) has the molecular formula C19H35N5O10 and a molecular weight of 493.51 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 171470743 |
| Molecular Formula | C19H35N5O10 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | (2S)-2-[[(1S)-5-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | NCCOCCOCCNC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H35N5O10/c20-6-9-33-11-12-34-10-8-22-18(31)21-7-2-1-3-13(16(27)28)23-19(32)24-14(17(29)30)4-5-15(25)26/h13-14H,1-12,20H2,(H,25,26)(H,27,28)(H,29,30)(H2,21,22,31)(H2,23,24,32)/t13-,14-/m0/s1 |
| InChIKey | BJSBTWAKQNHIGW-KBPBESRZSA-N |
| XLogP | -1.48 |
| TPSA | 238.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|