C15H25N3O8 — CID 118400178
(2S)-2-[[(1S)-1-carboxy-5-(propanoylamino)pentyl]carbamoylamino]pentanedioic acid (PubChem CID 118400178) has the molecular formula C15H25N3O8 and a molecular weight of 375.38 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-(propanoylamino)pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-(propanoylamino)pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 118400178 |
| Molecular Formula | C15H25N3O8 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-(propanoylamino)pentyl]carbamoylamino]pentanedioic acid |
| SMILES | CCC(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H25N3O8/c1-2-11(19)16-8-4-3-5-9(13(22)23)17-15(26)18-10(14(24)25)6-7-12(20)21/h9-10H,2-8H2,1H3,(H,16,19)(H,20,21)(H,22,23)(H,24,25)(H2,17,18,26)/t9-,10-/m0/s1 |
| InChIKey | MXZLJMQTKWYLFQ-UWVGGRQHSA-N |
| XLogP | -0.25 |
| TPSA | 182.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|