C16H33N3O7 — CID 144767958
2-[[(1S)-1-carboxy-5-(methylamino)pentyl]carbamoylamino]pentanedioic acid;ethane;methane (PubChem CID 144767958) has the molecular formula C16H33N3O7 and a molecular weight of 379.45 g/mol. Its IUPAC name is 2-[[(1S)-1-carboxy-5-(methylamino)pentyl]carbamoylamino]pentanedioic acid;ethane;methane.
| Compound Name | 2-[[(1S)-1-carboxy-5-(methylamino)pentyl]carbamoylamino]pentanedioic acid;ethane;methane |
|---|---|
| PubChem CID | 144767958 |
| Molecular Formula | C16H33N3O7 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-[[(1S)-1-carboxy-5-(methylamino)pentyl]carbamoylamino]pentanedioic acid;ethane;methane |
| SMILES | C.CC.CNCCCC[C@H](NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H23N3O7.C2H6.CH4/c1-14-7-3-2-4-8(11(19)20)15-13(23)16-9(12(21)22)5-6-10(17)18;1-2;/h8-9,14H,2-7H2,1H3,(H,17,18)(H,19,20)(H,21,22)(H2,15,16,23);1-2H3;1H4/t8-,9?;;/m0../s1 |
| InChIKey | GRMAWEVCHDEOQC-NWWUXDCXSA-N |
| XLogP | 1.11 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|