C13H23N3O8 — CID 163881420
(2S)-2-[[(1S)-1-carboxy-5-(hydroxymethylamino)pentyl]carbamoylamino]pentanedioic acid (PubChem CID 163881420) has the molecular formula C13H23N3O8 and a molecular weight of 349.34 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-(hydroxymethylamino)pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-(hydroxymethylamino)pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 163881420 |
| Molecular Formula | C13H23N3O8 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-(hydroxymethylamino)pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNCO)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H23N3O8/c17-7-14-6-2-1-3-8(11(20)21)15-13(24)16-9(12(22)23)4-5-10(18)19/h8-9,14,17H,1-7H2,(H,18,19)(H,20,21)(H,22,23)(H2,15,16,24)/t8-,9-/m0/s1 |
| InChIKey | PTNHKPQXUVLYRY-IUCAKERBSA-N |
| XLogP | -1.23 |
| TPSA | 185.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|