C20H31N3O7 — CID 143671998
2-[[1-carboxy-6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]hexan-2-yl]carbamoylamino]pentanedioic acid (PubChem CID 143671998) has the molecular formula C20H31N3O7 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[[1-carboxy-6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]hexan-2-yl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[1-carboxy-6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]hexan-2-yl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 143671998 |
| Molecular Formula | C20H31N3O7 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[[1-carboxy-6-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]hexan-2-yl]carbamoylamino]pentanedioic acid |
| SMILES | C=C/C=C(\C=C)CNCCCCC(CC(=O)O)NC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H31N3O7/c1-3-7-14(4-2)13-21-11-6-5-8-15(12-18(26)27)22-20(30)23-16(19(28)29)9-10-17(24)25/h3-4,7,15-16,21H,1-2,5-6,8-13H2,(H,24,25)(H,26,27)(H,28,29)(H2,22,23,30)/b14-7+ |
| InChIKey | UPESYKXEWFTRRK-VGOFMYFVSA-N |
| XLogP | 1.51 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|