C21H31N3O7 — CID 59775612
(3S)-3-[[(1S)-1-carboxy-5-[(4-methylphenyl)methylamino]pentyl]carbamoylamino]hexanedioic acid (PubChem CID 59775612) has the molecular formula C21H31N3O7 and a molecular weight of 437.49 g/mol. Its IUPAC name is (3S)-3-[[(1S)-1-carboxy-5-[(4-methylphenyl)methylamino]pentyl]carbamoylamino]hexanedioic acid.
| Compound Name | (3S)-3-[[(1S)-1-carboxy-5-[(4-methylphenyl)methylamino]pentyl]carbamoylamino]hexanedioic acid |
|---|---|
| PubChem CID | 59775612 |
| Molecular Formula | C21H31N3O7 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (3S)-3-[[(1S)-1-carboxy-5-[(4-methylphenyl)methylamino]pentyl]carbamoylamino]hexanedioic acid |
| SMILES | Cc1ccc(CNCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C21H31N3O7/c1-14-5-7-15(8-6-14)13-22-11-3-2-4-17(20(29)30)24-21(31)23-16(12-19(27)28)9-10-18(25)26/h5-8,16-17,22H,2-4,9-13H2,1H3,(H,25,26)(H,27,28)(H,29,30)(H2,23,24,31)/t16-,17-/m0/s1 |
| InChIKey | PLSYTXMAJBARAE-IRXDYDNUSA-N |
| XLogP | 1.72 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|