C18H27N3O5 — CID 143672051
2-(2-carboxyethylcarbamoylamino)-6-[(4-methylphenyl)methylamino]hexanoic acid (PubChem CID 143672051) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(2-carboxyethylcarbamoylamino)-6-[(4-methylphenyl)methylamino]hexanoic acid.
| Compound Name | 2-(2-carboxyethylcarbamoylamino)-6-[(4-methylphenyl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 143672051 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-(2-carboxyethylcarbamoylamino)-6-[(4-methylphenyl)methylamino]hexanoic acid |
| SMILES | Cc1ccc(CNCCCCC(NC(=O)NCCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H27N3O5/c1-13-5-7-14(8-6-13)12-19-10-3-2-4-15(17(24)25)21-18(26)20-11-9-16(22)23/h5-8,15,19H,2-4,9-12H2,1H3,(H,22,23)(H,24,25)(H2,20,21,26) |
| InChIKey | IQVPFVPXXGGVAL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|