C22H38N4O4 — CID 159392850
(2S)-6-(benzylcarbamoylamino)-2-(propan-2-ylcarbamoylamino)hexanoic acid;2-methylpropane (PubChem CID 159392850) has the molecular formula C22H38N4O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is (2S)-6-(benzylcarbamoylamino)-2-(propan-2-ylcarbamoylamino)hexanoic acid;2-methylpropane.
| Compound Name | (2S)-6-(benzylcarbamoylamino)-2-(propan-2-ylcarbamoylamino)hexanoic acid;2-methylpropane |
|---|---|
| PubChem CID | 159392850 |
| Molecular Formula | C22H38N4O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | (2S)-6-(benzylcarbamoylamino)-2-(propan-2-ylcarbamoylamino)hexanoic acid;2-methylpropane |
| SMILES | CC(C)C.CC(C)NC(=O)N[C@@H](CCCCNC(=O)NCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H28N4O4.C4H10/c1-13(2)21-18(26)22-15(16(23)24)10-6-7-11-19-17(25)20-12-14-8-4-3-5-9-14;1-4(2)3/h3-5,8-9,13,15H,6-7,10-12H2,1-2H3,(H,23,24)(H2,19,20,25)(H2,21,22,26);4H,1-3H3/t15-;/m0./s1 |
| InChIKey | LMIMICDJOVGSJX-RSAXXLAASA-N |
| XLogP | 3.48 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|