C13H20N2O2 — CID 108871315
1-benzyl-3-(5-hydroxypentyl)urea (PubChem CID 108871315) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-benzyl-3-(5-hydroxypentyl)urea.
| Compound Name | 1-benzyl-3-(5-hydroxypentyl)urea |
|---|---|
| PubChem CID | 108871315 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-benzyl-3-(5-hydroxypentyl)urea |
| SMILES | O=C(NCCCCCO)NCc1ccccc1 |
| InChI | InChI=1S/C13H20N2O2/c16-10-6-2-5-9-14-13(17)15-11-12-7-3-1-4-8-12/h1,3-4,7-8,16H,2,5-6,9-11H2,(H2,14,15,17) |
| InChIKey | FRZQBQURUCCCPN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|