C11H16N2O2 — CID 11298735
1-benzyl-3-(3-hydroxypropyl)urea (PubChem CID 11298735) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-benzyl-3-(3-hydroxypropyl)urea.
| Compound Name | 1-benzyl-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 11298735 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-benzyl-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)NCc1ccccc1 |
| InChI | InChI=1S/C11H16N2O2/c14-8-4-7-12-11(15)13-9-10-5-2-1-3-6-10/h1-3,5-6,14H,4,7-9H2,(H2,12,13,15) |
| InChIKey | CSGRKNXFBXXDQK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|