C12H19N2O4P — CID 167094446
4-(benzylcarbamoylamino)butylphosphonic acid (PubChem CID 167094446) has the molecular formula C12H19N2O4P and a molecular weight of 286.27 g/mol. Its IUPAC name is 4-(benzylcarbamoylamino)butylphosphonic acid.
| Compound Name | 4-(benzylcarbamoylamino)butylphosphonic acid |
|---|---|
| PubChem CID | 167094446 |
| Molecular Formula | C12H19N2O4P |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-(benzylcarbamoylamino)butylphosphonic acid |
| SMILES | O=C(NCCCCP(=O)(O)O)NCc1ccccc1 |
| InChI | InChI=1S/C12H19N2O4P/c15-12(13-8-4-5-9-19(16,17)18)14-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H2,13,14,15)(H2,16,17,18) |
| InChIKey | UVYUQTRORRAXLN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|