About 1-benzyl-3-methylurea;ethane
1-benzyl-3-methylurea;ethane (PubChem CID 90763782) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-benzyl-3-methylurea;ethane.
Molecular Properties
| Compound Name | 1-benzyl-3-methylurea;ethane |
| PubChem CID | 90763782 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 1-benzyl-3-methylurea;ethane |
| SMILES | CC.CC.CC.CNC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C9H12N2O.3C2H6/c1-10-9(12)11-7-8-5-3-2-4-6-8;3*1-2/h2-6H,7H2,1H3,(H2,10,11,12);3*1-2H3 |
| InChIKey | XAFJMGZYMVRHOA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-3-methylurea;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-methylurea;ethane?
The IUPAC name of 1-benzyl-3-methylurea;ethane (CID 90763782) is 1-benzyl-3-methylurea;ethane.
What is the SMILES notation for 1-benzyl-3-methylurea;ethane?
The canonical SMILES for 1-benzyl-3-methylurea;ethane is CC.CC.CC.CNC(=O)NCc1ccccc1.
What is the InChIKey of 1-benzyl-3-methylurea;ethane?
The InChIKey is XAFJMGZYMVRHOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.3C2H6/c1-10-9(12)11-7-8-5-3-2-4-6-8;3*1-2/h2-6H,7H2,1H3,(H2,10,11,12);3*1-2H3.
What are the key properties of 1-benzyl-3-methylurea;ethane?
1-benzyl-3-methylurea;ethane has a molecular weight of 254.42 g/mol, XLogP of 4.19, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-methylurea;ethane is sourced from PubChem (CID 90763782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).