C13H23N3O — CID 142017066
ethane;1-methyl-3-[[3-(methylaminomethyl)phenyl]methyl]urea (PubChem CID 142017066) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is ethane;1-methyl-3-[[3-(methylaminomethyl)phenyl]methyl]urea.
| Compound Name | ethane;1-methyl-3-[[3-(methylaminomethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 142017066 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | ethane;1-methyl-3-[[3-(methylaminomethyl)phenyl]methyl]urea |
| SMILES | CC.CNCc1cccc(CNC(=O)NC)c1 |
| InChI | InChI=1S/C11H17N3O.C2H6/c1-12-7-9-4-3-5-10(6-9)8-14-11(15)13-2;1-2/h3-6,12H,7-8H2,1-2H3,(H2,13,14,15);1-2H3 |
| InChIKey | SXXHBTLELXDZGF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |