C11H14N4O — CID 108864734
1-[[3-(aminomethyl)phenyl]methyl]-3-(cyanomethyl)urea (PubChem CID 108864734) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-[[3-(aminomethyl)phenyl]methyl]-3-(cyanomethyl)urea.
| Compound Name | 1-[[3-(aminomethyl)phenyl]methyl]-3-(cyanomethyl)urea |
|---|---|
| PubChem CID | 108864734 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-[[3-(aminomethyl)phenyl]methyl]-3-(cyanomethyl)urea |
| SMILES | N#CCNC(=O)NCc1cccc(CN)c1 |
| InChI | InChI=1S/C11H14N4O/c12-4-5-14-11(16)15-8-10-3-1-2-9(6-10)7-13/h1-3,6H,5,7-8,13H2,(H2,14,15,16) |
| InChIKey | OXMIVGSINSTOHB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|