C19H26N4O — CID 159960728
1,3-bis[[3-(2-aminoethyl)phenyl]methyl]urea (PubChem CID 159960728) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 1,3-bis[[3-(2-aminoethyl)phenyl]methyl]urea.
| Compound Name | 1,3-bis[[3-(2-aminoethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 159960728 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1,3-bis[[3-(2-aminoethyl)phenyl]methyl]urea |
| SMILES | NCCc1cccc(CNC(=O)NCc2cccc(CCN)c2)c1 |
| InChI | InChI=1S/C19H26N4O/c20-9-7-15-3-1-5-17(11-15)13-22-19(24)23-14-18-6-2-4-16(12-18)8-10-21/h1-6,11-12H,7-10,13-14,20-21H2,(H2,22,23,24) |
| InChIKey | ODHFMPCMSOYNOV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |