C11H19Cl2N3O — CID 138011978
3-amino-N-[[3-(aminomethyl)phenyl]methyl]propanamide;dihydrochloride (PubChem CID 138011978) has the molecular formula C11H19Cl2N3O and a molecular weight of 280.20 g/mol. Its IUPAC name is 3-amino-N-[[3-(aminomethyl)phenyl]methyl]propanamide;dihydrochloride.
| Compound Name | 3-amino-N-[[3-(aminomethyl)phenyl]methyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 138011978 |
| Molecular Formula | C11H19Cl2N3O |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-amino-N-[[3-(aminomethyl)phenyl]methyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCC(=O)NCc1cccc(CN)c1 |
| InChI | InChI=1S/C11H17N3O.2ClH/c12-5-4-11(15)14-8-10-3-1-2-9(6-10)7-13;;/h1-3,6H,4-5,7-8,12-13H2,(H,14,15);2*1H |
| InChIKey | WGYCAPTVUBZEGU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |