C19H23N3O3 — CID 59934759
N-[[3-(aminomethyl)phenyl]methyl]-N'-(2-hydroxy-5-methylphenyl)butanediamide (PubChem CID 59934759) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-N'-(2-hydroxy-5-methylphenyl)butanediamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(2-hydroxy-5-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 59934759 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(2-hydroxy-5-methylphenyl)butanediamide |
| SMILES | Cc1ccc(O)c(NC(=O)CCC(=O)NCc2cccc(CN)c2)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-13-5-6-17(23)16(9-13)22-19(25)8-7-18(24)21-12-15-4-2-3-14(10-15)11-20/h2-6,9-10,23H,7-8,11-12,20H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | YFEHSHNOUILVAS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|