C11H14N2O4 — CID 87750237
N'-hydroxy-N-(2-hydroxy-5-methylphenyl)butanediamide (PubChem CID 87750237) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is N'-hydroxy-N-(2-hydroxy-5-methylphenyl)butanediamide.
| Compound Name | N'-hydroxy-N-(2-hydroxy-5-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 87750237 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N'-hydroxy-N-(2-hydroxy-5-methylphenyl)butanediamide |
| SMILES | Cc1ccc(O)c(NC(=O)CCC(=O)NO)c1 |
| InChI | InChI=1S/C11H14N2O4/c1-7-2-3-9(14)8(6-7)12-10(15)4-5-11(16)13-17/h2-3,6,14,17H,4-5H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | QKJAKNSBRXYWHT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|