C11H13NO4 — CID 53375446
methyl 3-(2-hydroxy-5-methylanilino)-3-oxopropanoate (PubChem CID 53375446) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl 3-(2-hydroxy-5-methylanilino)-3-oxopropanoate.
| Compound Name | methyl 3-(2-hydroxy-5-methylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 53375446 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | methyl 3-(2-hydroxy-5-methylanilino)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1cc(C)ccc1O |
| InChI | InChI=1S/C11H13NO4/c1-7-3-4-9(13)8(5-7)12-10(14)6-11(15)16-2/h3-5,13H,6H2,1-2H3,(H,12,14) |
| InChIKey | PBXFAIWRKQSVHB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|