C11H14N2O5S — CID 71146069
methyl 3-(4-methyl-2-sulfamoylanilino)-3-oxopropanoate (PubChem CID 71146069) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is methyl 3-(4-methyl-2-sulfamoylanilino)-3-oxopropanoate.
| Compound Name | methyl 3-(4-methyl-2-sulfamoylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 71146069 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | methyl 3-(4-methyl-2-sulfamoylanilino)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1ccc(C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H14N2O5S/c1-7-3-4-8(9(5-7)19(12,16)17)13-10(14)6-11(15)18-2/h3-5H,6H2,1-2H3,(H,13,14)(H2,12,16,17) |
| InChIKey | VCRRIDPZVZGRSB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|