C11H16N2O3S — CID 167944439
N-(2,4-dimethylphenyl)-3-sulfamoylpropanamide (PubChem CID 167944439) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-sulfamoylpropanamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-sulfamoylpropanamide |
|---|---|
| PubChem CID | 167944439 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-sulfamoylpropanamide |
| SMILES | Cc1ccc(NC(=O)CCS(N)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C11H16N2O3S/c1-8-3-4-10(9(2)7-8)13-11(14)5-6-17(12,15)16/h3-4,7H,5-6H2,1-2H3,(H,13,14)(H2,12,15,16) |
| InChIKey | ZWAHXQXXVWKKBP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |