C19H25N3O3S — CID 109027685
N-(2,4-dimethylphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide (PubChem CID 109027685) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 109027685 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide |
| SMILES | Cc1ccc(NC(=O)CCNCCc2ccc(S(N)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C19H25N3O3S/c1-14-3-8-18(15(2)13-14)22-19(23)10-12-21-11-9-16-4-6-17(7-5-16)26(20,24)25/h3-8,13,21H,9-12H2,1-2H3,(H,22,23)(H2,20,24,25) |
| InChIKey | FBJNWQGWYMPIII-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|