C19H25N3O3S — CID 109019770
N-[(4-methylphenyl)methyl]-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide (PubChem CID 109019770) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide.
| Compound Name | N-[(4-methylphenyl)methyl]-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 109019770 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-3-[2-(4-sulfamoylphenyl)ethylamino]propanamide |
| SMILES | Cc1ccc(CNC(=O)CCNCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-15-2-4-17(5-3-15)14-22-19(23)11-13-21-12-10-16-6-8-18(9-7-16)26(20,24)25/h2-9,21H,10-14H2,1H3,(H,22,23)(H2,20,24,25) |
| InChIKey | MMJRRVDOIXZNLN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|