C18H22N2O3S — CID 50971111
3-(3,5-dimethylphenyl)-N-[(4-sulfamoylphenyl)methyl]propanamide (PubChem CID 50971111) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-N-[(4-sulfamoylphenyl)methyl]propanamide.
| Compound Name | 3-(3,5-dimethylphenyl)-N-[(4-sulfamoylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 50971111 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-N-[(4-sulfamoylphenyl)methyl]propanamide |
| SMILES | Cc1cc(C)cc(CCC(=O)NCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H22N2O3S/c1-13-9-14(2)11-16(10-13)5-8-18(21)20-12-15-3-6-17(7-4-15)24(19,22)23/h3-4,6-7,9-11H,5,8,12H2,1-2H3,(H,20,21)(H2,19,22,23) |
| InChIKey | ZONCHVPERXYZEW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |