C18H22ClN3O3S — CID 109002577
N-(2-chloro-4,6-dimethylphenyl)-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide (PubChem CID 109002577) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 109002577 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNCCc2ccc(S(N)(=O)=O)cc2)c(Cl)c1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-12-9-13(2)18(16(19)10-12)22-17(23)11-21-8-7-14-3-5-15(6-4-14)26(20,24)25/h3-6,9-10,21H,7-8,11H2,1-2H3,(H,22,23)(H2,20,24,25) |
| InChIKey | WTWSWRVNYWVXPG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|