C19H23ClN2O — CID 109005062
N-(2-chloro-4,6-dimethylphenyl)-2-(3-phenylpropylamino)acetamide (PubChem CID 109005062) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-(3-phenylpropylamino)acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3-phenylpropylamino)acetamide |
|---|---|
| PubChem CID | 109005062 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3-phenylpropylamino)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNCCCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O/c1-14-11-15(2)19(17(20)12-14)22-18(23)13-21-10-6-9-16-7-4-3-5-8-16/h3-5,7-8,11-12,21H,6,9-10,13H2,1-2H3,(H,22,23) |
| InChIKey | UGOMDLPAPQBFBA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|