C15H24ClN3O — CID 108995128
N-(2-chloro-4,6-dimethylphenyl)-2-[3-(dimethylamino)propylamino]acetamide (PubChem CID 108995128) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-[3-(dimethylamino)propylamino]acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-[3-(dimethylamino)propylamino]acetamide |
|---|---|
| PubChem CID | 108995128 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-[3-(dimethylamino)propylamino]acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNCCCN(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H24ClN3O/c1-11-8-12(2)15(13(16)9-11)18-14(20)10-17-6-5-7-19(3)4/h8-9,17H,5-7,10H2,1-4H3,(H,18,20) |
| InChIKey | VKUMIEWCDMLHQE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|