C13H18ClNO2 — CID 79018968
N-(2-chloro-4,6-dimethylphenyl)-5-hydroxypentanamide (PubChem CID 79018968) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-5-hydroxypentanamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-5-hydroxypentanamide |
|---|---|
| PubChem CID | 79018968 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-5-hydroxypentanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCCO)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO2/c1-9-7-10(2)13(11(14)8-9)15-12(17)5-3-4-6-16/h7-8,16H,3-6H2,1-2H3,(H,15,17) |
| InChIKey | SWDKENZMZPQKDX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|