C14H17ClN2O2 — CID 108941280
N'-(2-chloro-4,6-dimethylphenyl)-N-prop-2-enylpropanediamide (PubChem CID 108941280) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is N'-(2-chloro-4,6-dimethylphenyl)-N-prop-2-enylpropanediamide.
| Compound Name | N'-(2-chloro-4,6-dimethylphenyl)-N-prop-2-enylpropanediamide |
|---|---|
| PubChem CID | 108941280 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N'-(2-chloro-4,6-dimethylphenyl)-N-prop-2-enylpropanediamide |
| SMILES | C=CCNC(=O)CC(=O)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C14H17ClN2O2/c1-4-5-16-12(18)8-13(19)17-14-10(3)6-9(2)7-11(14)15/h4,6-7H,1,5,8H2,2-3H3,(H,16,18)(H,17,19) |
| InChIKey | HASQQDYSPUSQEH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|