C13H17ClN2O3 — CID 43466438
3-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]amino]propanoic acid (PubChem CID 43466438) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 3-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]amino]propanoic acid.
| Compound Name | 3-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43466438 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-[[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl]amino]propanoic acid |
| SMILES | Cc1cc(C)c(NC(=O)CNCCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O3/c1-8-5-9(2)13(10(14)6-8)16-11(17)7-15-4-3-12(18)19/h5-6,15H,3-4,7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | GCWVTSFJLDRXIZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|