C13H18BrNO — CID 18423533
4-bromo-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 18423533) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is 4-bromo-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-bromo-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 18423533 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-bromo-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCBr)c(C)c1 |
| InChI | InChI=1S/C13H18BrNO/c1-9-7-10(2)13(11(3)8-9)15-12(16)5-4-6-14/h7-8H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | VPWCNIKXLFXKCA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|