C17H27N2O2+ — CID 6942433
4-morpholin-4-ium-4-yl-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 6942433) has the molecular formula C17H27N2O2+ and a molecular weight of 291.42 g/mol. Its IUPAC name is 4-morpholin-4-ium-4-yl-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-morpholin-4-ium-4-yl-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 6942433 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 4-morpholin-4-ium-4-yl-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCC[NH+]2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C17H26N2O2/c1-13-11-14(2)17(15(3)12-13)18-16(20)5-4-6-19-7-9-21-10-8-19/h11-12H,4-10H2,1-3H3,(H,18,20)/p+1 |
| InChIKey | MYMPGJXTYMQSIF-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |