C20H32N2O2 — CID 11508231
N-(2,6-dimethyl-4-morpholin-4-ylphenyl)octanamide (PubChem CID 11508231) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-morpholin-4-ylphenyl)octanamide.
| Compound Name | N-(2,6-dimethyl-4-morpholin-4-ylphenyl)octanamide |
|---|---|
| PubChem CID | 11508231 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N-(2,6-dimethyl-4-morpholin-4-ylphenyl)octanamide |
| SMILES | CCCCCCCC(=O)Nc1c(C)cc(N2CCOCC2)cc1C |
| InChI | InChI=1S/C20H32N2O2/c1-4-5-6-7-8-9-19(23)21-20-16(2)14-18(15-17(20)3)22-10-12-24-13-11-22/h14-15H,4-13H2,1-3H3,(H,21,23) |
| InChIKey | ZYQZHRXKSVPLEG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|