C30H52N2O2 — CID 101068768
N-[2-(decanoylamino)-3,4,5,6-tetramethylphenyl]decanamide (PubChem CID 101068768) has the molecular formula C30H52N2O2 and a molecular weight of 472.76 g/mol. Its IUPAC name is N-[2-(decanoylamino)-3,4,5,6-tetramethylphenyl]decanamide.
| Compound Name | N-[2-(decanoylamino)-3,4,5,6-tetramethylphenyl]decanamide |
|---|---|
| PubChem CID | 101068768 |
| Molecular Formula | C30H52N2O2 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.40 |
| IUPAC Name | N-[2-(decanoylamino)-3,4,5,6-tetramethylphenyl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1c(C)c(C)c(C)c(C)c1NC(=O)CCCCCCCCC |
| InChI | InChI=1S/C30H52N2O2/c1-7-9-11-13-15-17-19-21-27(33)31-29-25(5)23(3)24(4)26(6)30(29)32-28(34)22-20-18-16-14-12-10-8-2/h7-22H2,1-6H3,(H,31,33)(H,32,34) |
| InChIKey | WKFVATGVFHGVMY-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|