C22H37NO — CID 54789598
N-(2,6-dimethylphenyl)tetradecanamide (PubChem CID 54789598) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)tetradecanamide.
| Compound Name | N-(2,6-dimethylphenyl)tetradecanamide |
|---|---|
| PubChem CID | 54789598 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | N-(2,6-dimethylphenyl)tetradecanamide |
| SMILES | CCCCCCCCCCCCCC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C22H37NO/c1-4-5-6-7-8-9-10-11-12-13-14-18-21(24)23-22-19(2)16-15-17-20(22)3/h15-17H,4-14,18H2,1-3H3,(H,23,24) |
| InChIKey | NOGPMMYSWWCSRI-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|