C20H33NO — CID 3411920
N-(2-methyl-6-propan-2-ylphenyl)decanamide (PubChem CID 3411920) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is N-(2-methyl-6-propan-2-ylphenyl)decanamide.
| Compound Name | N-(2-methyl-6-propan-2-ylphenyl)decanamide |
|---|---|
| PubChem CID | 3411920 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | N-(2-methyl-6-propan-2-ylphenyl)decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1c(C)cccc1C(C)C |
| InChI | InChI=1S/C20H33NO/c1-5-6-7-8-9-10-11-15-19(22)21-20-17(4)13-12-14-18(20)16(2)3/h12-14,16H,5-11,15H2,1-4H3,(H,21,22) |
| InChIKey | SVOASNDIPYKALF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|