C31H53NO — CID 71684537
(Z)-N-[2,6-di(propan-2-yl)phenyl]nonadec-10-enamide (PubChem CID 71684537) has the molecular formula C31H53NO and a molecular weight of 455.77 g/mol. Its IUPAC name is (Z)-N-[2,6-di(propan-2-yl)phenyl]nonadec-10-enamide.
| Compound Name | (Z)-N-[2,6-di(propan-2-yl)phenyl]nonadec-10-enamide |
|---|---|
| PubChem CID | 71684537 |
| Molecular Formula | C31H53NO |
| Molecular Weight | 455.77 g/mol |
| Exact Mass | 455.41 |
| IUPAC Name | (Z)-N-[2,6-di(propan-2-yl)phenyl]nonadec-10-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C31H53NO/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-30(33)32-31-28(26(2)3)23-22-24-29(31)27(4)5/h13-14,22-24,26-27H,6-12,15-21,25H2,1-5H3,(H,32,33)/b14-13- |
| InChIKey | BKTMBORCFLZCDA-YPKPFQOOSA-N |
| XLogP | 10.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.77 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|