C28H47NO — CID 15743064
(Z)-N-(2,6-diethylphenyl)octadec-9-enamide (PubChem CID 15743064) has the molecular formula C28H47NO and a molecular weight of 413.69 g/mol. Its IUPAC name is (Z)-N-(2,6-diethylphenyl)octadec-9-enamide.
| Compound Name | (Z)-N-(2,6-diethylphenyl)octadec-9-enamide |
|---|---|
| PubChem CID | 15743064 |
| Molecular Formula | C28H47NO |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.37 |
| IUPAC Name | (Z)-N-(2,6-diethylphenyl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C28H47NO/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-27(30)29-28-25(5-2)22-21-23-26(28)6-3/h13-14,21-23H,4-12,15-20,24H2,1-3H3,(H,29,30)/b14-13- |
| InChIKey | RNRHGLUMOKYNIA-YPKPFQOOSA-N |
| XLogP | 8.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|