C17H25NO2 — CID 71337961
N-(2,6-diethylphenyl)-3-oxoheptanamide (PubChem CID 71337961) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-3-oxoheptanamide.
| Compound Name | N-(2,6-diethylphenyl)-3-oxoheptanamide |
|---|---|
| PubChem CID | 71337961 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-(2,6-diethylphenyl)-3-oxoheptanamide |
| SMILES | CCCCC(=O)CC(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C17H25NO2/c1-4-7-11-15(19)12-16(20)18-17-13(5-2)9-8-10-14(17)6-3/h8-10H,4-7,11-12H2,1-3H3,(H,18,20) |
| InChIKey | YBEZOTVLEHCMKB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|