C13H18N2OS — CID 28942377
3-amino-N-(2,6-diethylphenyl)-3-sulfanylidenepropanamide (PubChem CID 28942377) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-amino-N-(2,6-diethylphenyl)-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(2,6-diethylphenyl)-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 28942377 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-amino-N-(2,6-diethylphenyl)-3-sulfanylidenepropanamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CC(N)=S |
| InChI | InChI=1S/C13H18N2OS/c1-3-9-6-5-7-10(4-2)13(9)15-12(16)8-11(14)17/h5-7H,3-4,8H2,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | AUVQODOSNFXGGS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|