C10H16N4S — CID 174777276
1-amino-3-[2-(aminomethyl)-6-ethylphenyl]thiourea (PubChem CID 174777276) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-amino-3-[2-(aminomethyl)-6-ethylphenyl]thiourea.
| Compound Name | 1-amino-3-[2-(aminomethyl)-6-ethylphenyl]thiourea |
|---|---|
| PubChem CID | 174777276 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-amino-3-[2-(aminomethyl)-6-ethylphenyl]thiourea |
| SMILES | CCc1cccc(CN)c1NC(=S)NN |
| InChI | InChI=1S/C10H16N4S/c1-2-7-4-3-5-8(6-11)9(7)13-10(15)14-12/h3-5H,2,6,11-12H2,1H3,(H2,13,14,15) |
| InChIKey | MHWRETRLLLRVOD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|