C12H19N3O — CID 13014243
2-(2,6-diethylanilino)acetohydrazide (PubChem CID 13014243) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(2,6-diethylanilino)acetohydrazide.
| Compound Name | 2-(2,6-diethylanilino)acetohydrazide |
|---|---|
| PubChem CID | 13014243 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-(2,6-diethylanilino)acetohydrazide |
| SMILES | CCc1cccc(CC)c1NCC(=O)NN |
| InChI | InChI=1S/C12H19N3O/c1-3-9-6-5-7-10(4-2)12(9)14-8-11(16)15-13/h5-7,14H,3-4,8,13H2,1-2H3,(H,15,16) |
| InChIKey | JAVFLGCTQKOUTK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|