C20H26N2O — CID 108999995
2-(2,6-diethylanilino)-N-(2-phenylethyl)acetamide (PubChem CID 108999995) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-(2,6-diethylanilino)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-(2,6-diethylanilino)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 108999995 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2-(2,6-diethylanilino)-N-(2-phenylethyl)acetamide |
| SMILES | CCc1cccc(CC)c1NCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-3-17-11-8-12-18(4-2)20(17)22-15-19(23)21-14-13-16-9-6-5-7-10-16/h5-12,22H,3-4,13-15H2,1-2H3,(H,21,23) |
| InChIKey | FPGRVWPHNZDHEO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |