C20H24N2O2 — CID 108947975
N'-(2-ethyl-6-methylphenyl)-N-(2-phenylethyl)propanediamide (PubChem CID 108947975) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is N'-(2-ethyl-6-methylphenyl)-N-(2-phenylethyl)propanediamide.
| Compound Name | N'-(2-ethyl-6-methylphenyl)-N-(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 108947975 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N'-(2-ethyl-6-methylphenyl)-N-(2-phenylethyl)propanediamide |
| SMILES | CCc1cccc(C)c1NC(=O)CC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H24N2O2/c1-3-17-11-7-8-15(2)20(17)22-19(24)14-18(23)21-13-12-16-9-5-4-6-10-16/h4-11H,3,12-14H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | RSWYQRXCMYEBGN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|