C21H26N2O3 — CID 108948559
N'-(2-ethyl-6-methylphenyl)-N-[2-(2-methoxyphenyl)ethyl]propanediamide (PubChem CID 108948559) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N'-(2-ethyl-6-methylphenyl)-N-[2-(2-methoxyphenyl)ethyl]propanediamide.
| Compound Name | N'-(2-ethyl-6-methylphenyl)-N-[2-(2-methoxyphenyl)ethyl]propanediamide |
|---|---|
| PubChem CID | 108948559 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N'-(2-ethyl-6-methylphenyl)-N-[2-(2-methoxyphenyl)ethyl]propanediamide |
| SMILES | CCc1cccc(C)c1NC(=O)CC(=O)NCCc1ccccc1OC |
| InChI | InChI=1S/C21H26N2O3/c1-4-16-10-7-8-15(2)21(16)23-20(25)14-19(24)22-13-12-17-9-5-6-11-18(17)26-3/h5-11H,4,12-14H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | FHOWRBXBYBUXCO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|