C18H30N2O — CID 109006644
2-(2,6-diethylanilino)-N,N-dipropylacetamide (PubChem CID 109006644) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-(2,6-diethylanilino)-N,N-dipropylacetamide.
| Compound Name | 2-(2,6-diethylanilino)-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 109006644 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 2-(2,6-diethylanilino)-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CNc1c(CC)cccc1CC |
| InChI | InChI=1S/C18H30N2O/c1-5-12-20(13-6-2)17(21)14-19-18-15(7-3)10-9-11-16(18)8-4/h9-11,19H,5-8,12-14H2,1-4H3 |
| InChIKey | LFLALLGKTLKRJC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |