C20H26N2S2 — CID 3582035
1-(2-benzylsulfanylethyl)-3-(2,6-diethylphenyl)thiourea (PubChem CID 3582035) has the molecular formula C20H26N2S2 and a molecular weight of 358.58 g/mol. Its IUPAC name is 1-(2-benzylsulfanylethyl)-3-(2,6-diethylphenyl)thiourea.
| Compound Name | 1-(2-benzylsulfanylethyl)-3-(2,6-diethylphenyl)thiourea |
|---|---|
| PubChem CID | 3582035 |
| Molecular Formula | C20H26N2S2 |
| Molecular Weight | 358.58 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-(2-benzylsulfanylethyl)-3-(2,6-diethylphenyl)thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)NCCSCc1ccccc1 |
| InChI | InChI=1S/C20H26N2S2/c1-3-17-11-8-12-18(4-2)19(17)22-20(23)21-13-14-24-15-16-9-6-5-7-10-16/h5-12H,3-4,13-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | ZMJDTHUWAWWCEH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|