C31H40N4S2 — CID 4829930
1-benzyl-3-(2,6-diethylphenyl)-1-[2-[(2,6-diethylphenyl)carbamothioylamino]ethyl]thiourea (PubChem CID 4829930) has the molecular formula C31H40N4S2 and a molecular weight of 532.82 g/mol. Its IUPAC name is 1-benzyl-3-(2,6-diethylphenyl)-1-[2-[(2,6-diethylphenyl)carbamothioylamino]ethyl]thiourea.
| Compound Name | 1-benzyl-3-(2,6-diethylphenyl)-1-[2-[(2,6-diethylphenyl)carbamothioylamino]ethyl]thiourea |
|---|---|
| PubChem CID | 4829930 |
| Molecular Formula | C31H40N4S2 |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 1-benzyl-3-(2,6-diethylphenyl)-1-[2-[(2,6-diethylphenyl)carbamothioylamino]ethyl]thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)NCCN(Cc1ccccc1)C(=S)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C31H40N4S2/c1-5-24-16-12-17-25(6-2)28(24)33-30(36)32-20-21-35(22-23-14-10-9-11-15-23)31(37)34-29-26(7-3)18-13-19-27(29)8-4/h9-19H,5-8,20-22H2,1-4H3,(H,34,37)(H2,32,33,36) |
| InChIKey | YECCPYJJCOJDHT-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|