C23H29N5S — CID 5112135
3-(2,6-diethylphenyl)-1-(3-imidazol-1-ylpropyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 5112135) has the molecular formula C23H29N5S and a molecular weight of 407.59 g/mol. Its IUPAC name is 3-(2,6-diethylphenyl)-1-(3-imidazol-1-ylpropyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(2,6-diethylphenyl)-1-(3-imidazol-1-ylpropyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 5112135 |
| Molecular Formula | C23H29N5S |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 3-(2,6-diethylphenyl)-1-(3-imidazol-1-ylpropyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)N(CCCn1ccnc1)Cc1cccnc1 |
| InChI | InChI=1S/C23H29N5S/c1-3-20-9-5-10-21(4-2)22(20)26-23(29)28(17-19-8-6-11-24-16-19)14-7-13-27-15-12-25-18-27/h5-6,8-12,15-16,18H,3-4,7,13-14,17H2,1-2H3,(H,26,29) |
| InChIKey | DBXUNFVWHLHWDS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|